C21H28N2O4S — CID 90115419
4-methylbenzenesulfonic acid;(2S)-1-methyl-N-[(1S)-1-phenylethyl]pyrrolidine-2-carboxamide (PubChem CID 90115419) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;(2S)-1-methyl-N-[(1S)-1-phenylethyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-methylbenzenesulfonic acid;(2S)-1-methyl-N-[(1S)-1-phenylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90115419 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-methylbenzenesulfonic acid;(2S)-1-methyl-N-[(1S)-1-phenylethyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1CCCN1C)c1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H20N2O.C7H8O3S/c1-11(12-7-4-3-5-8-12)15-14(17)13-9-6-10-16(13)2;1-6-2-4-7(5-3-6)11(8,9)10/h3-5,7-8,11,13H,6,9-10H2,1-2H3,(H,15,17);2-5H,1H3,(H,8,9,10)/t11-,13-;/m0./s1 |
| InChIKey | LCDOFWKCYIDOBH-JZKFLRDJSA-N |
| XLogP | 3.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|