C23H29ClN4O3 — CID 170956229
1-(2-amino-3-methylbutanoyl)-N-[1-[4-(2-chloro-3-pyridinyl)phenyl]-2-hydroxyethyl]pyrrolidine-2-carboxamide (PubChem CID 170956229) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is 1-(2-amino-3-methylbutanoyl)-N-[1-[4-(2-chloro-3-pyridinyl)phenyl]-2-hydroxyethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-amino-3-methylbutanoyl)-N-[1-[4-(2-chloro-3-pyridinyl)phenyl]-2-hydroxyethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170956229 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-(2-amino-3-methylbutanoyl)-N-[1-[4-(2-chloro-3-pyridinyl)phenyl]-2-hydroxyethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(N)C(=O)N1CCCC1C(=O)NC(CO)c1ccc(-c2cccnc2Cl)cc1 |
| InChI | InChI=1S/C23H29ClN4O3/c1-14(2)20(25)23(31)28-12-4-6-19(28)22(30)27-18(13-29)16-9-7-15(8-10-16)17-5-3-11-26-21(17)24/h3,5,7-11,14,18-20,29H,4,6,12-13,25H2,1-2H3,(H,27,30) |
| InChIKey | IJSKOSXYDAEPFA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|