C24H33FN4O3 — CID 170955994
N-[1-[4-(3-fluoro-2-pyridinyl)phenyl]-2-hydroxyethyl]-1-formylpyrrolidine-2-carboxamide;3-methylbutan-2-amine (PubChem CID 170955994) has the molecular formula C24H33FN4O3 and a molecular weight of 444.55 g/mol. Its IUPAC name is N-[1-[4-(3-fluoro-2-pyridinyl)phenyl]-2-hydroxyethyl]-1-formylpyrrolidine-2-carboxamide;3-methylbutan-2-amine.
| Compound Name | N-[1-[4-(3-fluoro-2-pyridinyl)phenyl]-2-hydroxyethyl]-1-formylpyrrolidine-2-carboxamide;3-methylbutan-2-amine |
|---|---|
| PubChem CID | 170955994 |
| Molecular Formula | C24H33FN4O3 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-[1-[4-(3-fluoro-2-pyridinyl)phenyl]-2-hydroxyethyl]-1-formylpyrrolidine-2-carboxamide;3-methylbutan-2-amine |
| SMILES | CC(C)C(C)N.O=CN1CCCC1C(=O)NC(CO)c1ccc(-c2ncccc2F)cc1 |
| InChI | InChI=1S/C19H20FN3O3.C5H13N/c20-15-3-1-9-21-18(15)14-7-5-13(6-8-14)16(11-24)22-19(26)17-4-2-10-23(17)12-25;1-4(2)5(3)6/h1,3,5-9,12,16-17,24H,2,4,10-11H2,(H,22,26);4-5H,6H2,1-3H3 |
| InChIKey | KCAYBTPLRACTQB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|