C23H26N2O4 — CID 11618135
[(1S,2S)-2-[[(2S)-1-formylpiperidine-2-carbonyl]amino]-1,2-diphenylethyl] acetate (PubChem CID 11618135) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [(1S,2S)-2-[[(2S)-1-formylpiperidine-2-carbonyl]amino]-1,2-diphenylethyl] acetate.
| Compound Name | [(1S,2S)-2-[[(2S)-1-formylpiperidine-2-carbonyl]amino]-1,2-diphenylethyl] acetate |
|---|---|
| PubChem CID | 11618135 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [(1S,2S)-2-[[(2S)-1-formylpiperidine-2-carbonyl]amino]-1,2-diphenylethyl] acetate |
| SMILES | CC(=O)O[C@@H](c1ccccc1)[C@@H](NC(=O)[C@@H]1CCCCN1C=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c1-17(27)29-22(19-12-6-3-7-13-19)21(18-10-4-2-5-11-18)24-23(28)20-14-8-9-15-25(20)16-26/h2-7,10-13,16,20-22H,8-9,14-15H2,1H3,(H,24,28)/t20-,21-,22-/m0/s1 |
| InChIKey | RSHYJKVRZCEMSO-FKBYEOEOSA-N |
| XLogP | 3.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|