C9H15N3O5 — CID 177316004
methyl 5-amino-2-[(2-formamidoacetyl)amino]-5-oxopentanoate (PubChem CID 177316004) has the molecular formula C9H15N3O5 and a molecular weight of 245.23 g/mol. Its IUPAC name is methyl 5-amino-2-[(2-formamidoacetyl)amino]-5-oxopentanoate.
| Compound Name | methyl 5-amino-2-[(2-formamidoacetyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 177316004 |
| Molecular Formula | C9H15N3O5 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | methyl 5-amino-2-[(2-formamidoacetyl)amino]-5-oxopentanoate |
| SMILES | COC(=O)C(CCC(N)=O)NC(=O)CNC=O |
| InChI | InChI=1S/C9H15N3O5/c1-17-9(16)6(2-3-7(10)14)12-8(15)4-11-5-13/h5-6H,2-4H2,1H3,(H2,10,14)(H,11,13)(H,12,15) |
| InChIKey | GATPYXQWZKEDPB-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|