C24H40N2O5 — CID 102572020
methyl (2S)-5-amino-2-[[(9Z,12Z,15Z)-17-hydroxyoctadeca-9,12,15-trienoyl]amino]-5-oxopentanoate (PubChem CID 102572020) has the molecular formula C24H40N2O5 and a molecular weight of 436.59 g/mol. Its IUPAC name is methyl (2S)-5-amino-2-[[(9Z,12Z,15Z)-17-hydroxyoctadeca-9,12,15-trienoyl]amino]-5-oxopentanoate.
| Compound Name | methyl (2S)-5-amino-2-[[(9Z,12Z,15Z)-17-hydroxyoctadeca-9,12,15-trienoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 102572020 |
| Molecular Formula | C24H40N2O5 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | methyl (2S)-5-amino-2-[[(9Z,12Z,15Z)-17-hydroxyoctadeca-9,12,15-trienoyl]amino]-5-oxopentanoate |
| SMILES | COC(=O)[C@H](CCC(N)=O)NC(=O)CCCCCCC/C=C\C/C=C\C/C=C\C(C)O |
| InChI | InChI=1S/C24H40N2O5/c1-20(27)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-23(29)26-21(24(30)31-2)18-19-22(25)28/h3-4,8,10,14,16,20-21,27H,5-7,9,11-13,15,17-19H2,1-2H3,(H2,25,28)(H,26,29)/b4-3-,10-8-,16-14-/t20?,21-/m0/s1 |
| InChIKey | FOTSIDBMUNAKKK-KGCVJBHYSA-N |
| XLogP | 3.47 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|