C41H66N2O6 — CID 11227734
(2S)-5-amino-2-[[(9Z,12Z,15Z)-17-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyoctadeca-9,12,15-trienoyl]amino]-5-oxopentanoic acid (PubChem CID 11227734) has the molecular formula C41H66N2O6 and a molecular weight of 682.99 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(9Z,12Z,15Z)-17-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyoctadeca-9,12,15-trienoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(9Z,12Z,15Z)-17-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyoctadeca-9,12,15-trienoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11227734 |
| Molecular Formula | C41H66N2O6 |
| Molecular Weight | 682.99 g/mol |
| Exact Mass | 682.49 |
| IUPAC Name | (2S)-5-amino-2-[[(9Z,12Z,15Z)-17-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyoctadeca-9,12,15-trienoyl]amino]-5-oxopentanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(C)/C=C\C/C=C\C/C=C\CCCCCCCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C41H66N2O6/c1-3-4-5-6-7-8-9-10-11-15-18-21-24-27-30-33-40(46)49-36(2)31-28-25-22-19-16-13-12-14-17-20-23-26-29-32-39(45)43-37(41(47)48)34-35-38(42)44/h4-5,7-8,10-13,19,22,28,31,36-37H,3,6,9,14-18,20-21,23-27,29-30,32-35H2,1-2H3,(H2,42,44)(H,43,45)(H,47,48)/b5-4-,8-7-,11-10-,13-12-,22-19-,31-28-/t36?,37-/m0/s1 |
| InChIKey | ZHNFFYUQIRVSBL-SUGHHNTCSA-N |
| XLogP | 9.52 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.99 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|