C41H70N2O6 — CID 11388362
(2S)-5-amino-2-[[(9Z,12Z)-17-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoctadeca-9,12-dienoyl]amino]-5-oxopentanoic acid (PubChem CID 11388362) has the molecular formula C41H70N2O6 and a molecular weight of 687.02 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(9Z,12Z)-17-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoctadeca-9,12-dienoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(9Z,12Z)-17-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoctadeca-9,12-dienoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11388362 |
| Molecular Formula | C41H70N2O6 |
| Molecular Weight | 687.02 g/mol |
| Exact Mass | 686.52 |
| IUPAC Name | (2S)-5-amino-2-[[(9Z,12Z)-17-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyoctadeca-9,12-dienoyl]amino]-5-oxopentanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(C)CCC/C=C\C/C=C\CCCCCCCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C41H70N2O6/c1-3-4-5-6-7-8-9-10-11-15-18-21-24-27-30-33-40(46)49-36(2)31-28-25-22-19-16-13-12-14-17-20-23-26-29-32-39(45)43-37(41(47)48)34-35-38(42)44/h7-8,10-13,19,22,36-37H,3-6,9,14-18,20-21,23-35H2,1-2H3,(H2,42,44)(H,43,45)(H,47,48)/b8-7-,11-10-,13-12-,22-19-/t36?,37-/m0/s1 |
| InChIKey | JXUQVYLJVDRCRN-YTFBZPRCSA-N |
| XLogP | 9.97 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.02 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|