C39H68N2O5 — CID 164500819
5-amino-2-[8-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxytetradecanoylamino]pentanoic acid (PubChem CID 164500819) has the molecular formula C39H68N2O5 and a molecular weight of 644.98 g/mol. Its IUPAC name is 5-amino-2-[8-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxytetradecanoylamino]pentanoic acid.
| Compound Name | 5-amino-2-[8-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxytetradecanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 164500819 |
| Molecular Formula | C39H68N2O5 |
| Molecular Weight | 644.98 g/mol |
| Exact Mass | 644.51 |
| IUPAC Name | 5-amino-2-[8-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxytetradecanoylamino]pentanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(CCCCCC)CCCCCCC(=O)NC(CCCN)C(=O)O |
| InChI | InChI=1S/C39H68N2O5/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-27-33-38(43)46-35(29-24-8-6-4-2)30-25-22-23-26-32-37(42)41-36(39(44)45)31-28-34-40/h5,7,10-11,13-14,16-17,35-36H,3-4,6,8-9,12,15,18-34,40H2,1-2H3,(H,41,42)(H,44,45)/b7-5-,11-10-,14-13-,17-16- |
| InChIKey | ZGZLSGHSGDWIKB-ZRENGBSJSA-N |
| XLogP | 9.66 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.98 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|