C45H80N2O7 — CID 164501325
2-[[2-[9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxyoctadecanoylamino]acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 164501325) has the molecular formula C45H80N2O7 and a molecular weight of 761.14 g/mol. Its IUPAC name is 2-[[2-[9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxyoctadecanoylamino]acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxyoctadecanoylamino]acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 164501325 |
| Molecular Formula | C45H80N2O7 |
| Molecular Weight | 761.14 g/mol |
| Exact Mass | 760.60 |
| IUPAC Name | 2-[[2-[9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxyoctadecanoylamino]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OC(CCCCCCCCC)CCCCCCCC(=O)NCC(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C45H80N2O7/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-29-33-37-44(51)54-40(34-30-26-23-10-8-6-4-2)35-31-27-25-28-32-36-42(49)46-38-43(50)47-41(39-48)45(52)53/h11-12,14-15,17-18,40-41,48H,3-10,13,16,19-39H2,1-2H3,(H,46,49)(H,47,50)(H,52,53)/b12-11-,15-14-,18-17- |
| InChIKey | ZHZHRFZUDNLXGY-IHDWIWDKSA-N |
| XLogP | 10.60 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.14 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|