C37H69NO5 — CID 164500425
2-[9-[(Z)-hexadec-9-enoyl]oxynonadecanoylamino]acetic acid (PubChem CID 164500425) has the molecular formula C37H69NO5 and a molecular weight of 607.96 g/mol. Its IUPAC name is 2-[9-[(Z)-hexadec-9-enoyl]oxynonadecanoylamino]acetic acid.
| Compound Name | 2-[9-[(Z)-hexadec-9-enoyl]oxynonadecanoylamino]acetic acid |
|---|---|
| PubChem CID | 164500425 |
| Molecular Formula | C37H69NO5 |
| Molecular Weight | 607.96 g/mol |
| Exact Mass | 607.52 |
| IUPAC Name | 2-[9-[(Z)-hexadec-9-enoyl]oxynonadecanoylamino]acetic acid |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC(CCCCCCCCCC)CCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C37H69NO5/c1-3-5-7-9-11-13-14-15-16-17-19-24-28-32-37(42)43-34(29-25-21-18-12-10-8-6-4-2)30-26-22-20-23-27-31-35(39)38-33-36(40)41/h13-14,34H,3-12,15-33H2,1-2H3,(H,38,39)(H,40,41)/b14-13- |
| InChIKey | ZGFOFNWQYCATSI-YPKPFQOOSA-N |
| XLogP | 10.62 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.96 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|