C51H90N2O7 — CID 164504218
2-[[2-[[(Z)-9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxytetracos-13-enoyl]amino]acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 164504218) has the molecular formula C51H90N2O7 and a molecular weight of 843.29 g/mol. Its IUPAC name is 2-[[2-[[(Z)-9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxytetracos-13-enoyl]amino]acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[(Z)-9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxytetracos-13-enoyl]amino]acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 164504218 |
| Molecular Formula | C51H90N2O7 |
| Molecular Weight | 843.29 g/mol |
| Exact Mass | 842.67 |
| IUPAC Name | 2-[[2-[[(Z)-9-[(10Z,13Z,16Z)-docosa-10,13,16-trienoyl]oxytetracos-13-enoyl]amino]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OC(CCC/C=C\CCCCCCCCCC)CCCCCCCC(=O)NCC(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C51H90N2O7/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-35-39-43-50(57)60-46(40-36-32-29-27-25-23-16-14-12-10-8-6-4-2)41-37-33-31-34-38-42-48(55)52-44-49(56)53-47(45-54)51(58)59/h11,13,17-18,20-21,27,29,46-47,54H,3-10,12,14-16,19,22-26,28,30-45H2,1-2H3,(H,52,55)(H,53,56)(H,58,59)/b13-11-,18-17-,21-20-,29-27- |
| InChIKey | ZNPJIBTXEOSZTQ-WOLLWPHFSA-N |
| XLogP | 12.71 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.29 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|