C28H50O4 — CID 138118372
(13Z,16Z)-9-hexanoyloxydocosa-13,16-dienoic acid (PubChem CID 138118372) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is (13Z,16Z)-9-hexanoyloxydocosa-13,16-dienoic acid.
| Compound Name | (13Z,16Z)-9-hexanoyloxydocosa-13,16-dienoic acid |
|---|---|
| PubChem CID | 138118372 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | (13Z,16Z)-9-hexanoyloxydocosa-13,16-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCC(CCCCCCCC(=O)O)OC(=O)CCCCC |
| InChI | InChI=1S/C28H50O4/c1-3-5-7-8-9-10-11-12-13-15-19-22-26(32-28(31)25-18-6-4-2)23-20-16-14-17-21-24-27(29)30/h9-10,12-13,26H,3-8,11,14-25H2,1-2H3,(H,29,30)/b10-9-,13-12- |
| InChIKey | AIBLJNOBKWQTOP-UTJQPWESSA-N |
| XLogP | 8.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|