C44H80N2O5 — CID 164507609
5-amino-2-[[(11Z,14Z)-10-[(Z)-octadec-9-enoyl]oxyhenicosa-11,14-dienoyl]amino]pentanoic acid (PubChem CID 164507609) has the molecular formula C44H80N2O5 and a molecular weight of 717.13 g/mol. Its IUPAC name is 5-amino-2-[[(11Z,14Z)-10-[(Z)-octadec-9-enoyl]oxyhenicosa-11,14-dienoyl]amino]pentanoic acid.
| Compound Name | 5-amino-2-[[(11Z,14Z)-10-[(Z)-octadec-9-enoyl]oxyhenicosa-11,14-dienoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 164507609 |
| Molecular Formula | C44H80N2O5 |
| Molecular Weight | 717.13 g/mol |
| Exact Mass | 716.61 |
| IUPAC Name | 5-amino-2-[[(11Z,14Z)-10-[(Z)-octadec-9-enoyl]oxyhenicosa-11,14-dienoyl]amino]pentanoic acid |
| SMILES | CCCCCC/C=C\C/C=C\C(CCCCCCCCC(=O)NC(CCCN)C(=O)O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H80N2O5/c1-3-5-7-9-11-13-14-15-16-17-18-20-22-28-32-38-43(48)51-40(34-29-25-21-19-12-10-8-6-4-2)35-30-26-23-24-27-31-37-42(47)46-41(44(49)50)36-33-39-45/h15-16,19,21,29,34,40-41H,3-14,17-18,20,22-28,30-33,35-39,45H2,1-2H3,(H,46,47)(H,49,50)/b16-15-,21-19-,34-29- |
| InChIKey | ZUHSAKOWIPKVRJ-XVKBEWMESA-N |
| XLogP | 11.84 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.13 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|