C37H68N2O5 — CID 164502115
5-amino-2-[[(Z)-8-[(Z)-hexadec-9-enoyl]oxyhexadec-9-enoyl]amino]pentanoic acid (PubChem CID 164502115) has the molecular formula C37H68N2O5 and a molecular weight of 620.96 g/mol. Its IUPAC name is 5-amino-2-[[(Z)-8-[(Z)-hexadec-9-enoyl]oxyhexadec-9-enoyl]amino]pentanoic acid.
| Compound Name | 5-amino-2-[[(Z)-8-[(Z)-hexadec-9-enoyl]oxyhexadec-9-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 164502115 |
| Molecular Formula | C37H68N2O5 |
| Molecular Weight | 620.96 g/mol |
| Exact Mass | 620.51 |
| IUPAC Name | 5-amino-2-[[(Z)-8-[(Z)-hexadec-9-enoyl]oxyhexadec-9-enoyl]amino]pentanoic acid |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC(/C=C\CCCCCC)CCCCCCC(=O)NC(CCCN)C(=O)O |
| InChI | InChI=1S/C37H68N2O5/c1-3-5-7-9-11-12-13-14-15-16-17-19-25-31-36(41)44-33(27-22-18-10-8-6-4-2)28-23-20-21-24-30-35(40)39-34(37(42)43)29-26-32-38/h12-13,22,27,33-34H,3-11,14-21,23-26,28-32,38H2,1-2H3,(H,39,40)(H,42,43)/b13-12-,27-22- |
| InChIKey | ZJLBGLZBRIXPPI-GPGLDSDNSA-N |
| XLogP | 9.33 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.96 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|