C21H31N5O6 — CID 142043058
methyl 4-[4-(aminomethyl)phenyl]-2-[[2-[3-[(2-formamidoacetyl)amino]butanoylamino]acetyl]amino]butanoate (PubChem CID 142043058) has the molecular formula C21H31N5O6 and a molecular weight of 449.51 g/mol. Its IUPAC name is methyl 4-[4-(aminomethyl)phenyl]-2-[[2-[3-[(2-formamidoacetyl)amino]butanoylamino]acetyl]amino]butanoate.
| Compound Name | methyl 4-[4-(aminomethyl)phenyl]-2-[[2-[3-[(2-formamidoacetyl)amino]butanoylamino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 142043058 |
| Molecular Formula | C21H31N5O6 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | methyl 4-[4-(aminomethyl)phenyl]-2-[[2-[3-[(2-formamidoacetyl)amino]butanoylamino]acetyl]amino]butanoate |
| SMILES | COC(=O)C(CCc1ccc(CN)cc1)NC(=O)CNC(=O)CC(C)NC(=O)CNC=O |
| InChI | InChI=1S/C21H31N5O6/c1-14(25-19(29)11-23-13-27)9-18(28)24-12-20(30)26-17(21(31)32-2)8-7-15-3-5-16(10-22)6-4-15/h3-6,13-14,17H,7-12,22H2,1-2H3,(H,23,27)(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | PBPRSCVNLZANTN-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|