C12H20N4O5 — CID 178034065
2-[(2-formamidoacetyl)amino]-N-(3-methyl-2-oxobutyl)butanediamide (PubChem CID 178034065) has the molecular formula C12H20N4O5 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[(2-formamidoacetyl)amino]-N-(3-methyl-2-oxobutyl)butanediamide.
| Compound Name | 2-[(2-formamidoacetyl)amino]-N-(3-methyl-2-oxobutyl)butanediamide |
|---|---|
| PubChem CID | 178034065 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[(2-formamidoacetyl)amino]-N-(3-methyl-2-oxobutyl)butanediamide |
| SMILES | CC(C)C(=O)CNC(=O)C(CC(N)=O)NC(=O)CNC=O |
| InChI | InChI=1S/C12H20N4O5/c1-7(2)9(18)4-15-12(21)8(3-10(13)19)16-11(20)5-14-6-17/h6-8H,3-5H2,1-2H3,(H2,13,19)(H,14,17)(H,15,21)(H,16,20) |
| InChIKey | QKNNGYZHYNMRLW-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|