C20H41N5O7S2 — CID 177034069
N-ethyl-2-(methylamino)acetamide;4-[(2-formamidoacetyl)amino]-5-[(3-methyl-2-oxobutyl)amino]-5-oxopentanoic acid;methanethiol (PubChem CID 177034069) has the molecular formula C20H41N5O7S2 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-ethyl-2-(methylamino)acetamide;4-[(2-formamidoacetyl)amino]-5-[(3-methyl-2-oxobutyl)amino]-5-oxopentanoic acid;methanethiol.
| Compound Name | N-ethyl-2-(methylamino)acetamide;4-[(2-formamidoacetyl)amino]-5-[(3-methyl-2-oxobutyl)amino]-5-oxopentanoic acid;methanethiol |
|---|---|
| PubChem CID | 177034069 |
| Molecular Formula | C20H41N5O7S2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | N-ethyl-2-(methylamino)acetamide;4-[(2-formamidoacetyl)amino]-5-[(3-methyl-2-oxobutyl)amino]-5-oxopentanoic acid;methanethiol |
| SMILES | CC(C)C(=O)CNC(=O)C(CCC(=O)O)NC(=O)CNC=O.CCNC(=O)CNC.CS.CS |
| InChI | InChI=1S/C13H21N3O6.C5H12N2O.2CH4S/c1-8(2)10(18)5-15-13(22)9(3-4-12(20)21)16-11(19)6-14-7-17;1-3-7-5(8)4-6-2;2*1-2/h7-9H,3-6H2,1-2H3,(H,14,17)(H,15,22)(H,16,19)(H,20,21);6H,3-4H2,1-2H3,(H,7,8);2*2H,1H3 |
| InChIKey | GZZALTHCTPQYNV-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 182.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|