C33H54N4O10 — CID 171804839
5-[[2-(ethylamino)-2-oxoethyl]amino]-4-[3-(4-methyl-3-oxopentoxy)propanoylamino]-5-oxopentanoic acid;(4-formamidophenyl)methyl 2-methylpropanoate;propane (PubChem CID 171804839) has the molecular formula C33H54N4O10 and a molecular weight of 666.81 g/mol. Its IUPAC name is 5-[[2-(ethylamino)-2-oxoethyl]amino]-4-[3-(4-methyl-3-oxopentoxy)propanoylamino]-5-oxopentanoic acid;(4-formamidophenyl)methyl 2-methylpropanoate;propane.
| Compound Name | 5-[[2-(ethylamino)-2-oxoethyl]amino]-4-[3-(4-methyl-3-oxopentoxy)propanoylamino]-5-oxopentanoic acid;(4-formamidophenyl)methyl 2-methylpropanoate;propane |
|---|---|
| PubChem CID | 171804839 |
| Molecular Formula | C33H54N4O10 |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.38 |
| IUPAC Name | 5-[[2-(ethylamino)-2-oxoethyl]amino]-4-[3-(4-methyl-3-oxopentoxy)propanoylamino]-5-oxopentanoic acid;(4-formamidophenyl)methyl 2-methylpropanoate;propane |
| SMILES | CC(C)C(=O)OCc1ccc(NC=O)cc1.CCC.CCNC(=O)CNC(=O)C(CCC(=O)O)NC(=O)CCOCCC(=O)C(C)C |
| InChI | InChI=1S/C18H31N3O7.C12H15NO3.C3H8/c1-4-19-16(24)11-20-18(27)13(5-6-17(25)26)21-15(23)8-10-28-9-7-14(22)12(2)3;1-9(2)12(15)16-7-10-3-5-11(6-4-10)13-8-14;1-3-2/h12-13H,4-11H2,1-3H3,(H,19,24)(H,20,27)(H,21,23)(H,25,26);3-6,8-9H,7H2,1-2H3,(H,13,14);3H2,1-2H3 |
| InChIKey | BQSPPNVRUSOXOP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 206.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|