C22H42N2O8 — CID 166816274
(4S)-5-oxo-5-(pentylamino)-4-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]pentanoic acid (PubChem CID 166816274) has the molecular formula C22H42N2O8 and a molecular weight of 462.58 g/mol. Its IUPAC name is (4S)-5-oxo-5-(pentylamino)-4-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]pentanoic acid.
| Compound Name | (4S)-5-oxo-5-(pentylamino)-4-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 166816274 |
| Molecular Formula | C22H42N2O8 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | (4S)-5-oxo-5-(pentylamino)-4-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]pentanoic acid |
| SMILES | CCCCCNC(=O)[C@H](CCC(=O)O)NC(=O)CCOCCOCCOCCOCCC |
| InChI | InChI=1S/C22H42N2O8/c1-3-5-6-10-23-22(28)19(7-8-21(26)27)24-20(25)9-12-30-14-16-32-18-17-31-15-13-29-11-4-2/h19H,3-18H2,1-2H3,(H,23,28)(H,24,25)(H,26,27)/t19-/m0/s1 |
| InChIKey | PFZMAWRCJOINGB-IBGZPJMESA-N |
| XLogP | 1.51 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|