C17H31N5O6 — CID 123601353
methyl 2-amino-5-[[2-[[2-[(2-formamidoacetyl)amino]-4-methylpentanoyl]amino]acetyl]amino]pentanoate (PubChem CID 123601353) has the molecular formula C17H31N5O6 and a molecular weight of 401.46 g/mol. Its IUPAC name is methyl 2-amino-5-[[2-[[2-[(2-formamidoacetyl)amino]-4-methylpentanoyl]amino]acetyl]amino]pentanoate.
| Compound Name | methyl 2-amino-5-[[2-[[2-[(2-formamidoacetyl)amino]-4-methylpentanoyl]amino]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 123601353 |
| Molecular Formula | C17H31N5O6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | methyl 2-amino-5-[[2-[[2-[(2-formamidoacetyl)amino]-4-methylpentanoyl]amino]acetyl]amino]pentanoate |
| SMILES | COC(=O)C(N)CCCNC(=O)CNC(=O)C(CC(C)C)NC(=O)CNC=O |
| InChI | InChI=1S/C17H31N5O6/c1-11(2)7-13(22-15(25)8-19-10-23)16(26)21-9-14(24)20-6-4-5-12(18)17(27)28-3/h10-13H,4-9,18H2,1-3H3,(H,19,23)(H,20,24)(H,21,26)(H,22,25) |
| InChIKey | KSVMJTBWEFDQAL-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|