C6H10N2O5 — CID 144619176
2-[(2-formamidoacetyl)amino]-3-hydroxypropanoic acid (PubChem CID 144619176) has the molecular formula C6H10N2O5 and a molecular weight of 190.15 g/mol. Its IUPAC name is 2-[(2-formamidoacetyl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(2-formamidoacetyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 144619176 |
| Molecular Formula | C6H10N2O5 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-[(2-formamidoacetyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=CNCC(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C6H10N2O5/c9-2-4(6(12)13)8-5(11)1-7-3-10/h3-4,9H,1-2H2,(H,7,10)(H,8,11)(H,12,13) |
| InChIKey | MNWOOXWGHXQKAZ-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|