C18H22N4O8 — CID 166919985
4-[[2-[(1-carboxy-2-phenylethyl)amino]-2-oxoethyl]amino]-3-[(2-formamidoacetyl)amino]-4-oxobutanoic acid (PubChem CID 166919985) has the molecular formula C18H22N4O8 and a molecular weight of 422.39 g/mol. Its IUPAC name is 4-[[2-[(1-carboxy-2-phenylethyl)amino]-2-oxoethyl]amino]-3-[(2-formamidoacetyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-[(1-carboxy-2-phenylethyl)amino]-2-oxoethyl]amino]-3-[(2-formamidoacetyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 166919985 |
| Molecular Formula | C18H22N4O8 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-[[2-[(1-carboxy-2-phenylethyl)amino]-2-oxoethyl]amino]-3-[(2-formamidoacetyl)amino]-4-oxobutanoic acid |
| SMILES | O=CNCC(=O)NC(CC(=O)O)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H22N4O8/c23-10-19-8-14(24)21-12(7-16(26)27)17(28)20-9-15(25)22-13(18(29)30)6-11-4-2-1-3-5-11/h1-5,10,12-13H,6-9H2,(H,19,23)(H,20,28)(H,21,24)(H,22,25)(H,26,27)(H,29,30) |
| InChIKey | YVXINXWCANSHKO-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|