C28H26N2O4 — CID 86655459
methyl (2S)-3-(1-methylindol-3-yl)-2-[3-(4-phenoxyphenyl)prop-2-enoylamino]propanoate (PubChem CID 86655459) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl (2S)-3-(1-methylindol-3-yl)-2-[3-(4-phenoxyphenyl)prop-2-enoylamino]propanoate.
| Compound Name | methyl (2S)-3-(1-methylindol-3-yl)-2-[3-(4-phenoxyphenyl)prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 86655459 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | methyl (2S)-3-(1-methylindol-3-yl)-2-[3-(4-phenoxyphenyl)prop-2-enoylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1cn(C)c2ccccc12)NC(=O)C=Cc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H26N2O4/c1-30-19-21(24-10-6-7-11-26(24)30)18-25(28(32)33-2)29-27(31)17-14-20-12-15-23(16-13-20)34-22-8-4-3-5-9-22/h3-17,19,25H,18H2,1-2H3,(H,29,31)/t25-/m0/s1 |
| InChIKey | YTBQLHRIGMQMLY-VWLOTQADSA-N |
| XLogP | 4.88 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|