C14H14N2O2 — CID 115764671
(E)-3-(3-cyanophenyl)-N-[1-(hydroxymethyl)cyclopropyl]prop-2-enamide (PubChem CID 115764671) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (E)-3-(3-cyanophenyl)-N-[1-(hydroxymethyl)cyclopropyl]prop-2-enamide.
| Compound Name | (E)-3-(3-cyanophenyl)-N-[1-(hydroxymethyl)cyclopropyl]prop-2-enamide |
|---|---|
| PubChem CID | 115764671 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (E)-3-(3-cyanophenyl)-N-[1-(hydroxymethyl)cyclopropyl]prop-2-enamide |
| SMILES | N#Cc1cccc(/C=C/C(=O)NC2(CO)CC2)c1 |
| InChI | InChI=1S/C14H14N2O2/c15-9-12-3-1-2-11(8-12)4-5-13(18)16-14(10-17)6-7-14/h1-5,8,17H,6-7,10H2,(H,16,18)/b5-4+ |
| InChIKey | MANWKOQISWCZIM-SNAWJCMRSA-N |
| XLogP | 1.21 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|