C15H18ClNO2 — CID 76945718
3-(3-chlorophenyl)-N-[1-(hydroxymethyl)cyclopentyl]prop-2-enamide (PubChem CID 76945718) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[1-(hydroxymethyl)cyclopentyl]prop-2-enamide.
| Compound Name | 3-(3-chlorophenyl)-N-[1-(hydroxymethyl)cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 76945718 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[1-(hydroxymethyl)cyclopentyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(Cl)c1)NC1(CO)CCCC1 |
| InChI | InChI=1S/C15H18ClNO2/c16-13-5-3-4-12(10-13)6-7-14(19)17-15(11-18)8-1-2-9-15/h3-7,10,18H,1-2,8-9,11H2,(H,17,19) |
| InChIKey | JOMZRRKMRFHJAB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|