C16H19ClFNO2 — CID 76945871
3-(2-chloro-6-fluorophenyl)-N-[1-(hydroxymethyl)cyclohexyl]prop-2-enamide (PubChem CID 76945871) has the molecular formula C16H19ClFNO2 and a molecular weight of 311.78 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-[1-(hydroxymethyl)cyclohexyl]prop-2-enamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-[1-(hydroxymethyl)cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 76945871 |
| Molecular Formula | C16H19ClFNO2 |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-[1-(hydroxymethyl)cyclohexyl]prop-2-enamide |
| SMILES | O=C(C=Cc1c(F)cccc1Cl)NC1(CO)CCCCC1 |
| InChI | InChI=1S/C16H19ClFNO2/c17-13-5-4-6-14(18)12(13)7-8-15(21)19-16(11-20)9-2-1-3-10-16/h4-8,20H,1-3,9-11H2,(H,19,21) |
| InChIKey | ZJBJGYJAFJLHFK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|