C15H17ClFNO3 — CID 107301757
(E)-3-(2-chloro-6-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]prop-2-enamide (PubChem CID 107301757) has the molecular formula C15H17ClFNO3 and a molecular weight of 313.76 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 107301757 |
| Molecular Formula | C15H17ClFNO3 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]prop-2-enamide |
| SMILES | CC1OCCC1(O)CNC(=O)/C=C/c1c(F)cccc1Cl |
| InChI | InChI=1S/C15H17ClFNO3/c1-10-15(20,7-8-21-10)9-18-14(19)6-5-11-12(16)3-2-4-13(11)17/h2-6,10,20H,7-9H2,1H3,(H,18,19)/b6-5+ |
| InChIKey | WASIIGGLRHEBPD-AATRIKPKSA-N |
| XLogP | 2.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|