C15H17BrFNO3 — CID 107301687
(E)-3-(5-bromo-2-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]prop-2-enamide (PubChem CID 107301687) has the molecular formula C15H17BrFNO3 and a molecular weight of 358.21 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 107301687 |
| Molecular Formula | C15H17BrFNO3 |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]prop-2-enamide |
| SMILES | CC1OCCC1(O)CNC(=O)/C=C/c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H17BrFNO3/c1-10-15(20,6-7-21-10)9-18-14(19)5-2-11-8-12(16)3-4-13(11)17/h2-5,8,10,20H,6-7,9H2,1H3,(H,18,19)/b5-2+ |
| InChIKey | OECKNYNWDFAZJC-GORDUTHDSA-N |
| XLogP | 2.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|