C13H15F2NO3 — CID 107302216
3,5-difluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzamide (PubChem CID 107302216) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 3,5-difluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzamide.
| Compound Name | 3,5-difluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107302216 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3,5-difluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzamide |
| SMILES | CC1OCCC1(O)CNC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H15F2NO3/c1-8-13(18,2-3-19-8)7-16-12(17)9-4-10(14)6-11(15)5-9/h4-6,8,18H,2-3,7H2,1H3,(H,16,17) |
| InChIKey | LARVRENUSYQLQE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |