C14H18FNO4 — CID 107301628
3-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-4-methoxybenzamide (PubChem CID 107301628) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is 3-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-4-methoxybenzamide.
| Compound Name | 3-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 107301628 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC2(O)CCOC2C)cc1F |
| InChI | InChI=1S/C14H18FNO4/c1-9-14(18,5-6-20-9)8-16-13(17)10-3-4-12(19-2)11(15)7-10/h3-4,7,9,18H,5-6,8H2,1-2H3,(H,16,17) |
| InChIKey | SXFOKUJBDUURBW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |