C16H19BrFNO2 — CID 115362482
(E)-3-(5-bromo-2-fluorophenyl)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]prop-2-enamide (PubChem CID 115362482) has the molecular formula C16H19BrFNO2 and a molecular weight of 356.24 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 115362482 |
| Molecular Formula | C16H19BrFNO2 |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[[1-(hydroxymethyl)cyclopentyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)NCC1(CO)CCCC1 |
| InChI | InChI=1S/C16H19BrFNO2/c17-13-4-5-14(18)12(9-13)3-6-15(21)19-10-16(11-20)7-1-2-8-16/h3-6,9,20H,1-2,7-8,10-11H2,(H,19,21)/b6-3+ |
| InChIKey | BTGUWCYNHJRMOK-ZZXKWVIFSA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|