C14H13N3O4 — CID 43465441
2-[[2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]acetyl]amino]acetic acid (PubChem CID 43465441) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-[[2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 43465441 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[[2-[[(E)-3-(3-cyanophenyl)prop-2-enoyl]amino]acetyl]amino]acetic acid |
| SMILES | N#Cc1cccc(/C=C/C(=O)NCC(=O)NCC(=O)O)c1 |
| InChI | InChI=1S/C14H13N3O4/c15-7-11-3-1-2-10(6-11)4-5-12(18)16-8-13(19)17-9-14(20)21/h1-6H,8-9H2,(H,16,18)(H,17,19)(H,20,21)/b5-4+ |
| InChIKey | ARHLGLFWBHDZSK-SNAWJCMRSA-N |
| XLogP | -0.11 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|