C13H11N5O — CID 54885145
(E)-3-(3-cyanophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide (PubChem CID 54885145) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is (E)-3-(3-cyanophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-cyanophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 54885145 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (E)-3-(3-cyanophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
| SMILES | N#Cc1cccc(/C=C/C(=O)NCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C13H11N5O/c14-7-11-3-1-2-10(6-11)4-5-13(19)15-8-12-16-9-17-18-12/h1-6,9H,8H2,(H,15,19)(H,16,17,18)/b5-4+ |
| InChIKey | PRUGMJXVLAEWQN-SNAWJCMRSA-N |
| XLogP | 1.01 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|