C14H13N5O — CID 77045805
3-(3-cyanophenyl)-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide (PubChem CID 77045805) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide.
| Compound Name | 3-(3-cyanophenyl)-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 77045805 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-(3-cyanophenyl)-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)C=Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H13N5O/c1-19(9-13-16-10-17-18-13)14(20)6-5-11-3-2-4-12(7-11)8-15/h2-7,10H,9H2,1H3,(H,16,17,18) |
| InChIKey | RXDMCHOQXFWDOI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|