C10H10N4O2 — CID 60982798
(E)-3-(furan-2-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide (PubChem CID 60982798) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 60982798 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NCc1ncn[nH]1 |
| InChI | InChI=1S/C10H10N4O2/c15-10(4-3-8-2-1-5-16-8)11-6-9-12-7-13-14-9/h1-5,7H,6H2,(H,11,15)(H,12,13,14)/b4-3+ |
| InChIKey | NDTIGMXDBKUIJL-ONEGZZNKSA-N |
| XLogP | 0.73 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|