C10H11F2NO3 — CID 104857087
(E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 104857087) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 104857087 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (E)-N-(2,2-difluoro-3-hydroxypropyl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NCC(F)(F)CO |
| InChI | InChI=1S/C10H11F2NO3/c11-10(12,7-14)6-13-9(15)4-3-8-2-1-5-16-8/h1-5,14H,6-7H2,(H,13,15)/b4-3+ |
| InChIKey | BNQKWWYWEIXPPY-ONEGZZNKSA-N |
| XLogP | 1.04 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|