C18H23N3O5 — CID 47592170
[4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 47592170) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 47592170 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | CCNC(=O)NC1CCC(OC(=O)/C=C/c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H23N3O5/c1-2-19-18(23)20-14-7-9-16(10-8-14)26-17(22)11-6-13-4-3-5-15(12-13)21(24)25/h3-6,11-12,14,16H,2,7-10H2,1H3,(H2,19,20,23)/b11-6+ |
| InChIKey | KUHFSBGRKYJORC-IZZDOVSWSA-N |
| XLogP | 2.78 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|