C31H36N4O6 — CID 99060409
(Z)-3-(3-nitrophenyl)-N-[4-[[4-[[(Z)-3-(3-nitrophenyl)prop-2-enoyl]amino]cyclohexyl]methyl]cyclohexyl]prop-2-enamide (PubChem CID 99060409) has the molecular formula C31H36N4O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is (Z)-3-(3-nitrophenyl)-N-[4-[[4-[[(Z)-3-(3-nitrophenyl)prop-2-enoyl]amino]cyclohexyl]methyl]cyclohexyl]prop-2-enamide.
| Compound Name | (Z)-3-(3-nitrophenyl)-N-[4-[[4-[[(Z)-3-(3-nitrophenyl)prop-2-enoyl]amino]cyclohexyl]methyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 99060409 |
| Molecular Formula | C31H36N4O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | (Z)-3-(3-nitrophenyl)-N-[4-[[4-[[(Z)-3-(3-nitrophenyl)prop-2-enoyl]amino]cyclohexyl]methyl]cyclohexyl]prop-2-enamide |
| SMILES | O=C(/C=C\c1cccc([N+](=O)[O-])c1)NC1CCC(CC2CCC(NC(=O)/C=C\c3cccc([N+](=O)[O-])c3)CC2)CC1 |
| InChI | InChI=1S/C31H36N4O6/c36-30(17-11-22-3-1-5-28(20-22)34(38)39)32-26-13-7-24(8-14-26)19-25-9-15-27(16-10-25)33-31(37)18-12-23-4-2-6-29(21-23)35(40)41/h1-6,11-12,17-18,20-21,24-27H,7-10,13-16,19H2,(H,32,36)(H,33,37)/b17-11-,18-12- |
| InChIKey | BQNMUGQSJSSPJH-WHYMJUELSA-N |
| XLogP | 5.97 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|