C17H21N3O3 — CID 56784248
(E)-N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 56784248) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is (E)-N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 56784248 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (E)-N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NCC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C17H21N3O3/c21-17(7-4-13-2-1-3-16(10-13)20(22)23)18-11-14-8-9-19(12-14)15-5-6-15/h1-4,7,10,14-15H,5-6,8-9,11-12H2,(H,18,21)/b7-4+ |
| InChIKey | VYZSBLMRESQRAZ-QPJJXVBHSA-N |
| XLogP | 2.21 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|