About [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate
[4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate (PubChem CID 75268944) has the molecular formula C16H23N3O3S
and a molecular weight of 337.45 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate.
Molecular Properties
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate |
| PubChem CID | 75268944 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate |
| SMILES | CCNC(=O)NC1CCC(OC(=O)C=Cc2csc(C)n2)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-17-16(21)19-12-4-7-14(8-5-12)22-15(20)9-6-13-10-23-11(2)18-13/h6,9-10,12,14H,3-5,7-8H2,1-2H3,(H2,17,19,21) |
| InChIKey | SCMBJVZLAZJAOR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate?
The IUPAC name of [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate (CID 75268944) is [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate.
What is the SMILES notation for [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate?
The canonical SMILES for [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate is CCNC(=O)NC1CCC(OC(=O)C=Cc2csc(C)n2)CC1.
What is the InChIKey of [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate?
The InChIKey is SCMBJVZLAZJAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O3S/c1-3-17-16(21)19-12-4-7-14(8-5-12)22-15(20)9-6-13-10-23-11(2)18-13/h6,9-10,12,14H,3-5,7-8H2,1-2H3,(H2,17,19,21).
What are the key properties of [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate?
[4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate has a molecular weight of 337.45 g/mol, XLogP of 2.64, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(ethylcarbamoylamino)cyclohexyl] 3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate is sourced from PubChem (CID 75268944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).