C7H13N3OS — CID 62698544
1-(3-amino-3-sulfanylidenepropyl)-3-cyclopropylurea (PubChem CID 62698544) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is 1-(3-amino-3-sulfanylidenepropyl)-3-cyclopropylurea.
| Compound Name | 1-(3-amino-3-sulfanylidenepropyl)-3-cyclopropylurea |
|---|---|
| PubChem CID | 62698544 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 1-(3-amino-3-sulfanylidenepropyl)-3-cyclopropylurea |
| SMILES | NC(=S)CCNC(=O)NC1CC1 |
| InChI | InChI=1S/C7H13N3OS/c8-6(12)3-4-9-7(11)10-5-1-2-5/h5H,1-4H2,(H2,8,12)(H2,9,10,11) |
| InChIKey | XYEAKTKXUVKSRC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|