About azetidin-3-ylurea
azetidin-3-ylurea (PubChem CID 66186769) has the molecular formula C4H9N3O
and a molecular weight of 115.14 g/mol. Its IUPAC name is azetidin-3-ylurea.
Molecular Properties
| Compound Name | azetidin-3-ylurea |
| PubChem CID | 66186769 |
| Molecular Formula | C4H9N3O |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | azetidin-3-ylurea |
| SMILES | NC(=O)NC1CNC1 |
| InChI | InChI=1S/C4H9N3O/c5-4(8)7-3-1-6-2-3/h3,6H,1-2H2,(H3,5,7,8) |
| InChIKey | OMWXUTJGALFBON-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azetidin-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-ylurea?
The IUPAC name of azetidin-3-ylurea (CID 66186769) is azetidin-3-ylurea.
What is the SMILES notation for azetidin-3-ylurea?
The canonical SMILES for azetidin-3-ylurea is NC(=O)NC1CNC1.
What is the InChIKey of azetidin-3-ylurea?
The InChIKey is OMWXUTJGALFBON-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O/c5-4(8)7-3-1-6-2-3/h3,6H,1-2H2,(H3,5,7,8).
What are the key properties of azetidin-3-ylurea?
azetidin-3-ylurea has a molecular weight of 115.14 g/mol, XLogP of -1.37, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-ylurea is sourced from PubChem (CID 66186769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).