C8H16N4O — CID 130611267
[1-(azetidin-3-yl)pyrrolidin-3-yl]urea (PubChem CID 130611267) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is [1-(azetidin-3-yl)pyrrolidin-3-yl]urea.
| Compound Name | [1-(azetidin-3-yl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 130611267 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | [1-(azetidin-3-yl)pyrrolidin-3-yl]urea |
| SMILES | NC(=O)NC1CCN(C2CNC2)C1 |
| InChI | InChI=1S/C8H16N4O/c9-8(13)11-6-1-2-12(5-6)7-3-10-4-7/h6-7,10H,1-5H2,(H3,9,11,13) |
| InChIKey | GZMDKIXFTBVNDJ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |