C11H23Cl2N3O — CID 119864797
2-amino-N-(1-cyclopropylpyrrolidin-3-yl)-2-methylpropanamide;dihydrochloride (PubChem CID 119864797) has the molecular formula C11H23Cl2N3O and a molecular weight of 284.23 g/mol. Its IUPAC name is 2-amino-N-(1-cyclopropylpyrrolidin-3-yl)-2-methylpropanamide;dihydrochloride.
| Compound Name | 2-amino-N-(1-cyclopropylpyrrolidin-3-yl)-2-methylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119864797 |
| Molecular Formula | C11H23Cl2N3O |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-amino-N-(1-cyclopropylpyrrolidin-3-yl)-2-methylpropanamide;dihydrochloride |
| SMILES | CC(C)(N)C(=O)NC1CCN(C2CC2)C1.Cl.Cl |
| InChI | InChI=1S/C11H21N3O.2ClH/c1-11(2,12)10(15)13-8-5-6-14(7-8)9-3-4-9;;/h8-9H,3-7,12H2,1-2H3,(H,13,15);2*1H |
| InChIKey | DAYIMYZEFGDZQN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |