C13H27N3O — CID 61264639
2-amino-N-(1-tert-butylpiperidin-4-yl)-2-methylpropanamide (PubChem CID 61264639) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-amino-N-(1-tert-butylpiperidin-4-yl)-2-methylpropanamide.
| Compound Name | 2-amino-N-(1-tert-butylpiperidin-4-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 61264639 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 2-amino-N-(1-tert-butylpiperidin-4-yl)-2-methylpropanamide |
| SMILES | CC(C)(N)C(=O)NC1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-12(2,3)16-8-6-10(7-9-16)15-11(17)13(4,5)14/h10H,6-9,14H2,1-5H3,(H,15,17) |
| InChIKey | TWVMVZCNVPZOQC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |