C14H27ClN2O — CID 63681125
N-(1-tert-butylpiperidin-4-yl)-3-chloro-2,2-dimethylpropanamide (PubChem CID 63681125) has the molecular formula C14H27ClN2O and a molecular weight of 274.84 g/mol. Its IUPAC name is N-(1-tert-butylpiperidin-4-yl)-3-chloro-2,2-dimethylpropanamide.
| Compound Name | N-(1-tert-butylpiperidin-4-yl)-3-chloro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63681125 |
| Molecular Formula | C14H27ClN2O |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-(1-tert-butylpiperidin-4-yl)-3-chloro-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NC1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27ClN2O/c1-13(2,3)17-8-6-11(7-9-17)16-12(18)14(4,5)10-15/h11H,6-10H2,1-5H3,(H,16,18) |
| InChIKey | VWKILPXXCHUYNE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|