C21H26ClN3O4 — CID 108564507
3-chloro-N-[1-[2-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 108564507) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is 3-chloro-N-[1-[2-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[1-[2-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 108564507 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-chloro-N-[1-[2-(1,3-dioxoisoindol-2-yl)propanoyl]piperidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C(=O)N1CCC(NC(=O)C(C)(C)CCl)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H26ClN3O4/c1-13(25-18(27)15-6-4-5-7-16(15)19(25)28)17(26)24-10-8-14(9-11-24)23-20(29)21(2,3)12-22/h4-7,13-14H,8-12H2,1-3H3,(H,23,29) |
| InChIKey | BQPUICZAJDZGTE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|