C19H20N4O4 — CID 108551631
N-[1-(2-cyanoacetyl)piperidin-4-yl]-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 108551631) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[1-(2-cyanoacetyl)piperidin-4-yl]-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[1-(2-cyanoacetyl)piperidin-4-yl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 108551631 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[1-(2-cyanoacetyl)piperidin-4-yl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)NC1CCN(C(=O)CC#N)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H20N4O4/c1-12(23-18(26)14-4-2-3-5-15(14)19(23)27)17(25)21-13-7-10-22(11-8-13)16(24)6-9-20/h2-5,12-13H,6-8,10-11H2,1H3,(H,21,25) |
| InChIKey | NUPWIKAWZPWFKQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|