C15H27ClN2O2 — CID 63680198
3-chloro-N-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 63680198) has the molecular formula C15H27ClN2O2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63680198 |
| Molecular Formula | C15H27ClN2O2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 3-chloro-N-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N1CCC(NC(=O)C(C)(C)CCl)CC1 |
| InChI | InChI=1S/C15H27ClN2O2/c1-14(2,3)13(20)18-8-6-11(7-9-18)17-12(19)15(4,5)10-16/h11H,6-10H2,1-5H3,(H,17,19) |
| InChIKey | DEXFHNOPMWLZTB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|